Quorumpeps Molecule

Quorumpeps®

NFGAPGGASPI

Quorumpeps moleculeID244
SMILESO=C(NC(C(=O)O)C(C)CC)C3N(C(=O)C(NC(=O)C(NC(=O)CNC(=O)CNC(=O)C2N(C(=O)C(NC(=O)CNC(=O)C(NC(=O)C(N)CC(=O)N)Cc1ccccc1)C)CCC2)C)CO)CCC3
Molecular formula C44H66N12O14
Chemical information
Species origin
Functionality
Literature