Quorumpeps Molecule

Quorumpeps®

GDSVCASYF, thiolacton linkage between C5 and F9

Quorumpeps moleculeID246
SMILESO=C(O)CC(NC(=O)CN)C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)Cc3ccc(O)cc3)CO)C)C(C)C)CO
Molecular formulaC41H55N9O14S
Chemical information
Species origin
Functionality
Literature