Quorumpeps Molecule

Quorumpeps®

SVCASYF, thiolacton linkage between C3 and F7

Quorumpeps moleculeID247
SMILESO=C(NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)Cc3ccc(O)cc3)CO)C)C(C)C)C(N)CO
Molecular formulaC35H47N7O10S
Chemical information
Species origin
Functionality
Literature