Quorumpeps Molecule

Quorumpeps®

SKADT

Quorumpeps moleculeID248
SMILESO=C(NC(C(=O)O)C(O)C)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CO)CCCCN)C)CC(=O)O
Molecular formula C20H36N6O10
Chemical information
Species origin
Functionality
Literature