Quorumpeps Molecule

Quorumpeps®

SKPAD

Quorumpeps moleculeID249
SMILESO=C(O)CC(C=O)NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CO)CCCCN)Cc1ccccc1)C
Molecular formulaC25H38N6O8
Chemical information
Species origin
Functionality
Literature