Quorumpeps Molecule

Quorumpeps®

CVFSLFKKCN

Quorumpeps moleculeID25
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CS)C(C)C)Cc1ccccc1)CO)CC(C)C)Cc2ccccc2)CCCCN)CCCCN)CS)CC(=O)N
Molecular formulaC54H85N13O13S2
Chemical information
Species origin
Functionality
Literature