Quorumpeps Molecule

Quorumpeps®

DSVSASYF, lacton linkage between S4 and F8

Quorumpeps moleculeID250
SMILESO=C(O)CC(N)C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC1)Cc2ccccc2)Cc3ccc(O)cc3)CO)C)C(C)C)CO
Molecular formula C39H52N8O14
Chemical information
Species origin
Functionality
Literature