Quorumpeps Molecule

Quorumpeps®

DSVDprASYF, lactam linkage between Dpr4 and F8

Quorumpeps moleculeID251
SMILESO=C(O)CC(N)C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1)Cc2ccccc2)Cc3ccc(O)cc3)CO)C)C(C)C)CO
Molecular formula C39H53N9O13
Chemical information
Species origin
Functionality
Literature