Quorumpeps Molecule

Quorumpeps®

SKPDT

Quorumpeps moleculeID252
SMILESO=C(NC(C(=O)NC(C(=O)O)C(O)C)CC(=O)O)C1N(C(=O)C(NC(=O)C(N)CO)CCCCN)CCC1
Molecular formulaC22H38N6O10
Chemical information
Species origin
Functionality
Literature