Quorumpeps Molecule

Quorumpeps®

ARGMT

Quorumpeps moleculeID253
SMILESO=C(NC(C(=O)NC(C(=O)O)C(O)C)CCSC)CNC(=O)C(NC(=O)C(N)C)CCCNC(=[N@H])N
Molecular formula C20H38N8O7S
Chemical information
Species origin
Functionality
Literature