Quorumpeps Molecule

Quorumpeps®

ERGQT

Quorumpeps moleculeID255
SMILESO=C(NC(C(=O)O)C(O)C)C(NC(=O)CNC(=O)C(NC(=O)C(N)CCC(=O)O)CCCNC(=[N@H])N)CCC(=O)N
Molecular formula C22H39N9O10
Chemical information
Species origin
Functionality
Literature