Quorumpeps Molecule

Quorumpeps®

ARNMT

Quorumpeps moleculeID256
SMILESO=C(NC(C(=O)NC(C(=O)O)C(O)C)CCSC)C(NC(=O)C(NC(=O)C(N)C)CCCNC(=[N@H])N)CC(=O)N
Molecular formula C22H41N9O8S
Chemical information
Species origin
Functionality
Literature