Quorumpeps Molecule

Quorumpeps®

ARGQT

Quorumpeps moleculeID257
SMILESO=C(NC(C(=O)O)C(O)C)C(NC(=O)CNC(=O)C(NC(=O)C(N)C)CCCNC(=[N@H])N)CCC(=O)N
Molecular formulaC20H37N9O8
Chemical information
Species origin
Functionality
Literature