Quorumpeps Molecule

Quorumpeps®

ERNQT

Quorumpeps moleculeID258
SMILESO=C(NC(C(=O)O)C(O)C)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CCC(=O)O)CCCNC(=[N@H])N)CC(=O)N)CCC(=O)N
Molecular formula C24H42N10O11
Chemical information
Species origin
Functionality
Literature