Quorumpeps Molecule

Quorumpeps®

ERAMT

Quorumpeps moleculeID259
SMILESO=C(NC(C(=O)NC(C(=O)O)C(O)C)CCSC)C(NC(=O)C(NC(=O)C(N)CCC(=O)O)CCCNC(=[N@H])N)C
Molecular formulaC23H42N8O9S
Chemical information
Species origin
Functionality
Literature