Quorumpeps Molecule

Quorumpeps®

NSPNIFGQWM, lacton linkage between S2 and M10

Quorumpeps moleculeID26
SMILESO=C(N)CC(N)C(=O)NC1C(=O)N5C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC1)CCSC)Cc3c2ccccc2nc3)CCC(=O)N)Cc4ccccc4)C(C)CC)CC(=O)N)CCC5
Molecular formulaC54H74N14O14S
Chemical information
Species origin
Functionality
Literature