Quorumpeps Molecule

Quorumpeps®

AKPDT

Quorumpeps moleculeID260
SMILESO=C(NC(C(=O)NC(C(=O)O)C(O)C)CC(=O)O)C1N(C(=O)C(NC(=O)C(N)C)CCCCN)CCC1
Molecular formula C22H38N6O9
Chemical information
Species origin
Functionality
Literature