Quorumpeps Molecule

Quorumpeps®

NVWNK

Quorumpeps moleculeID261
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CC(=O)N)C(C)C)Cc2c1ccccc1nc2)CC(=O)N)CCCCN
Molecular formula C30H45N9O8
Chemical information
Species origin
Functionality
Literature