Quorumpeps Molecule

Quorumpeps®

PLWCA

Quorumpeps moleculeID262
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)O)C)CS)Cc2c1ccccc1nc2)CC(C)C)C3NCCC3
Molecular formula C28H40N6O6S
Chemical information
Species origin
Functionality
Literature