Quorumpeps Molecule

Quorumpeps®

NIWNR

Quorumpeps moleculeID263
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CC(=O)N)C(C)CC)Cc2c1ccccc1nc2)CC(=O)N)CCCNC(=[N@H])N
Molecular formula C31H47N11O8
Chemical information
Species origin
Functionality
Literature