Quorumpeps Molecule

Quorumpeps®

DICNAYF, thiolacton linkage between C3 and F7

Quorumpeps moleculeID27
SMILESO=C(O)CC(N)C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)Cc3ccc(O)cc3)C)CC(=O)N)C(C)CC
Molecular formulaC38H50N8O11S
Chemical information
Species origin
Literature