Quorumpeps Molecule

Quorumpeps®

benzyloxycarbonyl-QNSAAAFGAWA, lacton linkage between S3 and A11

Quorumpeps moleculeID270
SMILESO=C(OCc1ccccc1)NCCC(=O)NC(C(=O)NC(C(=O)NC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC2)C)Cc4c3ccccc3nc4)C)Cc5ccccc5)C)C)C)CC(=O)N)CCC(=O)N
Molecular formulaC60H77N15O17
Chemical information
Species origin
Functionality
Literature