Quorumpeps Molecule

Quorumpeps®

benzyloxycarbonyl-QNSAAAFGAWM, lacton linkage between S3 and M11

Quorumpeps moleculeID271
SMILESO=C(OCc1ccccc1)NCCC(=O)NC(C(=O)NC(C(=O)NC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC2)CCSC)Cc4c3ccccc3nc4)C)Cc5ccccc5)C)C)C)CC(=O)N)CCC(=O)N
Molecular formula C62H81N15O17S
Chemical information
Species origin
Functionality
Literature