Quorumpeps Molecule

Quorumpeps®

benzyloxycarbonyl-QNSPAIFGAWM, lacton linkage between S3 and M11

Quorumpeps moleculeID281
SMILESO=C(N)CCC(NC(=O)CCNC(=O)OCc1ccccc1)C(=O)NC(C(=O)NC2C(=O)N6C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC2)CCSC)Cc4c3ccccc3nc4)C)Cc5ccccc5)C(C)CC)C)CCC6)CC(=O)N
Molecular formulaC67H89N15O17S
Chemical information
Species origin
Functionality
Literature