Quorumpeps Molecule

Quorumpeps®

benzyloxycarbonyl-QNSPF(pentafluor)IFGAWA, lacton linkage between S3 and A11

Quorumpeps moleculeID283
SMILESO=C(N)CCC(NC(=O)CCNC(=O)OCc1ccccc1)C(=O)NC(C(=O)NC2C(=O)N7C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC2)C)Cc4c3ccccc3nc4)C)Cc5ccccc5)C(C)CC)Cc6c(F)c(F)c(F)c(F)c6F)CCC7)CC(=O)N
Molecular formula C71H84F5N15O17
Chemical information
Species origin
Functionality
Literature