Quorumpeps Molecule

Quorumpeps®

benzyloxycarbonyl-QNSPD(Obzl)IFGAWA, lacton linkage between S3 and A11

Quorumpeps moleculeID285
SMILESO=C(N)CCC(NC(=O)CCNC(=O)OCc1ccccc1)C(=O)NC(C(=O)NC2C(=O)N7C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC2)C)Cc4c3ccccc3nc4)C)Cc5ccccc5)C(C)CC)CC(=O)OCc6ccccc6)CCC7)CC(=O)N
Molecular formula C73H91N15O19
Chemical information
Species origin
Functionality
Literature