Quorumpeps Molecule

Quorumpeps®

QNSPNIFGQF(D)M, lacton linkage between S3 and M11

Quorumpeps moleculeID288
SMILESO=C(N)CCC(N)C(=O)NC(C(=O)NC1C(=O)N4C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC1)CCSC)Cc2ccccc2)CCC(=O)N)Cc3ccccc3)C(C)CC)CC(=O)N)CCC4)CC(=O)N
Molecular formulaC57H81N15O16S
Chemical information
Species origin
Functionality
Literature