Quorumpeps Molecule

Quorumpeps®

Ac-QNSPNIFGQWM, lacton linkage between S3 and M11

Quorumpeps moleculeID289
SMILESO=C(N)CCC(NC(=O)C)C(=O)NC(C(=O)NC1C(=O)N5C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC1)CCSC)Cc3c2ccccc2nc3)CCC(=O)N)Cc4ccccc4)C(C)CC)CC(=O)N)CCC5)CC(=O)N
Molecular formulaC61H84N16O17S
Chemical information
Species origin
Functionality
Literature