Quorumpeps Molecule

Quorumpeps®

YSTC(alpha-aminobutyric acid)FIM, thiolacton linkage between C4 and M8

Quorumpeps moleculeID291
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CCSC)C(C)CC)Cc2ccccc2)CC)C(O)C)CO)C(N)Cc3ccc(O)cc3
Molecular formula C43H62N8O11S2
Chemical information
Species origin
Functionality
Literature