Quorumpeps Molecule

Quorumpeps®

N-4-(4-benzylphenoxy)butyryl-STCAFIM, thiolacton linkage between C4 and M8

Quorumpeps moleculeID292
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CCSC)C(C)CC)Cc2ccccc2)C)C(O)C)CO)CCCOc3ccccc3Cc4ccccc4
Molecular formula C50H67N7O11S2
Chemical information
Species origin
Functionality
Literature