Quorumpeps Molecule

Quorumpeps®

N-4-(4-benzoylphenoxy)butyryl-STCAFIM, thiolacton linkage between C4 and M8

Quorumpeps moleculeID293
SMILESO=C(c1ccccc1)c4ccccc4OCCCC(=O)NC(C(=O)NC(C(=O)NC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC2)CCSC)C(C)CC)Cc3ccccc3)C)C(O)C)CO
Molecular formula C50H65N7O12S2
Chemical information
Species origin
Functionality
Literature