Quorumpeps Molecule

Quorumpeps®

NASKYNPCSNYL, thiolacton linkage between C8 and L12

Quorumpeps moleculeID294
SMILESO=C(N)CC(N)C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC2)CC(C)C)Cc3ccc(O)cc3)CC(=O)N)CO)CC(=O)N)Cc4ccc(O)cc4)CCCCN)CO)C
Molecular formula C59H86N16O19S
Chemical information
Species origin
Functionality
Literature