Quorumpeps Molecule

Quorumpeps®

AMDIIIIVGG

Quorumpeps moleculeID299
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NCC(=O)O)C(C)C)C(C)CC)C(C)CC)C(C)CC)C(C)CC)CC(=O)O)CCSC)C(N)C
Molecular formula C45H80N10O13S
Chemical information
Species origin
Functionality
Literature