Quorumpeps Molecule

Quorumpeps®

Ac-CDFIF, thiolacton linkage between C1 and F5

Quorumpeps moleculeID3
SMILESO=C(O)CC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SCC(C(=O)N1)NC(=O)C)Cc2ccccc2)C(C)CC)Cc3ccccc3
Molecular formulaC33H41N5O8S
Chemical information
Species origin
Functionality
Literature