Quorumpeps Molecule

Quorumpeps®

DLRGVPNPWGWIFGR

Quorumpeps moleculeID30
SMILESO=C(NC(C(=O)NCC(=O)NC(C(=O)O)CCCNC(=[N@H])N)Cc1ccccc1)C(NC(=O)C(NC(=O)CNC(=O)C(NC(=O)C3N(C(=O)C(NC(=O)C2N(C(=O)C(NC(=O)CNC(=O)C(NC(=O)C(NC(=O)C(N)CC(=O)O)CC(C)C)CCCNC(=[N@H])N)C(C)C)CCC2)CC(=O)N)CCC3)Cc5c4ccccc4nc5)Cc7c6ccccc6nc7)C(CC)C
Molecular formulaC84H120N24O19
Chemical information
Species origin
Functionality
Literature