Quorumpeps Molecule

Quorumpeps®

IIIIVGG

Quorumpeps moleculeID301
SMILESO=C(NCC(=O)O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)C(C)CC)C(C)CC)C(C)CC)C(C)CC)C(C)C
Molecular formulaC33H61N7O8
Chemical information
Species origin
Functionality
Literature