Quorumpeps Molecule

Quorumpeps®

KW(farnesyl)PPIE

Quorumpeps moleculeID302
SMILESO=C(O)C(NC(=O)C(NC(=O)C5N(C(=O)C4N(C(=O)C2N(C(=O)C(N)CCCCN)C3Nc1ccccc1C3(C2)C\C=C(/C)CC\C=C(/C)CC\C=C(/C)C)CCC4)CCC5)C(C)CC)CCC(=O)O
Molecular formulaC53H80N8O9
Chemical information
Species origin
Functionality
Literature