Quorumpeps Molecule

Quorumpeps®

CFMFV, thiolacton linkage between C1 and V5

Quorumpeps moleculeID304
SMILESO=C1SCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1C(C)C)Cc2ccccc2)CCSC)Cc3ccccc3)N
Molecular formulaC31H41N5O5S2
Chemical information
Species origin
Functionality
Literature