Quorumpeps Molecule

Quorumpeps®

SFFIF, lacton linkage between S1 and F5

Quorumpeps moleculeID305
SMILESO=C1OCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1Cc2ccccc2)C(C)CC)Cc3ccccc3)Cc4ccccc4)N
Molecular formulaC36H43N5O6
Chemical information
Species origin
Functionality
Literature