Quorumpeps Molecule

Quorumpeps®

LDWWSLG

Quorumpeps moleculeID306
SMILESO=C(O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CC(C)C)CC(=O)O)Cc2c1ccccc1nc2)Cc4c3ccccc3nc4)C(O)C)CC(C)C
Molecular formulaC44H59N9O11
Chemical information
Species origin
Functionality
Literature