Quorumpeps Molecule

Quorumpeps®

TGWWMLG

Quorumpeps moleculeID307
SMILESO=C(O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(N)C(O)C)Cc2c1ccccc1nc2)Cc4c3ccccc3nc4)CCSC)CCCCN
Molecular formulaC41H56N10O9S
Chemical information
Species origin
Functionality
Literature