Quorumpeps Molecule

Quorumpeps®

ETEWWNVG

Quorumpeps moleculeID308
SMILESO=C(O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CCC(=O)O)C(O)C)CCC(=O)O)Cc2c1ccccc1nc2)Cc4c3ccccc3nc4)CC(=O)N)C(C)C
Molecular formulaC47H61N11O15
Chemical information
Species origin
Functionality
Literature