Quorumpeps Molecule

Quorumpeps®

CLWFT

Quorumpeps moleculeID309
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CS)CC(C)C)Cc2c1ccccc1nc2)Cc3ccccc3)C(O)C
Molecular formulaC33H44N6O7S
Chemical information
Species origin
Functionality
Literature