Quorumpeps Molecule

Quorumpeps®

CLWFT, thiolacton linkage between C1 and T5

Quorumpeps moleculeID310
SMILESO=C1SCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1C(O)C)Cc2ccccc2)Cc4c3ccccc3nc4)CC(C)C)N
Molecular formulaC33H42N6O6S
Chemical information
Species origin
Functionality
Literature