Quorumpeps Molecule

Quorumpeps®

SLWFT

Quorumpeps moleculeID311
SMILESO=C(O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CO)CC(C)C)Cc2c1ccccc1nc2)Cc3ccccc3)C(O)C
Molecular formulaC33H44N6O8
Chemical information
Species origin
Functionality
Literature