Quorumpeps Molecule

Quorumpeps®

TSACLWFT, thiolacton linkage between C4 and T8

Quorumpeps moleculeID313
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)C(O)C)Cc2ccccc2)Cc4c3ccccc3nc4)CC(C)C)C)CO)C(N)C(O)C
Molecular formulaC43H59N9O11S
Chemical information
Species origin
Functionality
Literature