Quorumpeps Molecule

Quorumpeps®

CLWFTH, thiolacton linkage between C1 and H6

Quorumpeps moleculeID314
SMILESO=C1SCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1Cc2ncnc2)C(O)C)Cc3ccccc3)Cc5c4ccccc4nc5)CC(C)C)N
Molecular formulaC39H49N9O7S
Chemical information
Species origin
Functionality
Literature