Quorumpeps Molecule

Quorumpeps®

TYLFTNS, lacton linkage between T1 and S7, modified at T1

Quorumpeps moleculeID316
SMILESO=C1OC(C(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1CO)CC(=O)N)C(O)C)Cc2ccccc2)CC(C)C)Cc3ccc(O)cc3)C)NC(=O)\C=C\c4ccccc4\C=C/CCC)C
Molecular formulaC54H70N8O13
Chemical information
Species origin
Functionality
Literature