Quorumpeps Molecule

Quorumpeps®

PFTFAFF, lacton linkage between T3 and F7, modified at P1, F6, F7

Quorumpeps moleculeID317
SMILESClc1ccc(n1)C(=O)NC(C(=O)NC4C(=O)NC(C(=O)NC(C(=O)NC(c2cc(O)cc(O)c2)C(=O)NC(c3cc(O)cc(O)c3)C(=O)OC4C)C)Cc5ccccc5)Cc6ccccc6
Molecular formulaC46H46ClN7O12
Chemical information
Species origin
Functionality
Literature