Quorumpeps Molecule

Quorumpeps®

IACDFLL, thiolacton linkage between C3 and L7

Quorumpeps moleculeID319
SMILESO=C(O)CC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SCC(C(=O)N1)NC(=O)C(NC(=O)C(N)C(C)CC)C)CC(C)C)CC(C)C)Cc2ccccc2
Molecular formulaC37H57N7O9S
Chemical information
Species origin
Functionality
Literature